About 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide
3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide (PubChem CID 89442035) has the molecular formula C8H10F3OP
and a molecular weight of 210.13 g/mol. Its IUPAC name is 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide.
Molecular Properties
| Compound Name | 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide |
| PubChem CID | 89442035 |
| Molecular Formula | C8H10F3OP |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide |
| SMILES | C#CC1CP(C)(=O)CC1C(F)(F)F |
| InChI | InChI=1S/C8H10F3OP/c1-3-6-4-13(2,12)5-7(6)8(9,10)11/h1,6-7H,4-5H2,2H3 |
| InChIKey | HWGHWDPVIRSFFC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide?
The IUPAC name of 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide (CID 89442035) is 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide.
What is the SMILES notation for 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide?
The canonical SMILES for 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide is C#CC1CP(C)(=O)CC1C(F)(F)F.
What is the InChIKey of 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide?
The InChIKey is HWGHWDPVIRSFFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3OP/c1-3-6-4-13(2,12)5-7(6)8(9,10)11/h1,6-7H,4-5H2,2H3.
What are the key properties of 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide?
3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide has a molecular weight of 210.13 g/mol, XLogP of 2.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-1-methyl-4-(trifluoromethyl)-1λ5-phospholane 1-oxide is sourced from PubChem (CID 89442035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).