About 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide
6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide (PubChem CID 89442082) has the molecular formula C8H13O3P
and a molecular weight of 188.16 g/mol. Its IUPAC name is 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide.
Molecular Properties
| Compound Name | 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide |
| PubChem CID | 89442082 |
| Molecular Formula | C8H13O3P |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide |
| SMILES | C#CC1CC(C)(C)CP(=O)(O)O1 |
| InChI | InChI=1S/C8H13O3P/c1-4-7-5-8(2,3)6-12(9,10)11-7/h1,7H,5-6H2,2-3H3,(H,9,10) |
| InChIKey | DHZPAHPDVYYGRM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide?
The IUPAC name of 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide (CID 89442082) is 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide.
What is the SMILES notation for 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide?
The canonical SMILES for 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide is C#CC1CC(C)(C)CP(=O)(O)O1.
What is the InChIKey of 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide?
The InChIKey is DHZPAHPDVYYGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O3P/c1-4-7-5-8(2,3)6-12(9,10)11-7/h1,7H,5-6H2,2-3H3,(H,9,10).
What are the key properties of 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide?
6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide has a molecular weight of 188.16 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethynyl-2-hydroxy-4,4-dimethyl-1,2λ5-oxaphosphinane 2-oxide is sourced from PubChem (CID 89442082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).