About 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide
5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide (PubChem CID 89442092) has the molecular formula C7H8OS
and a molecular weight of 140.21 g/mol. Its IUPAC name is 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide.
Molecular Properties
| Compound Name | 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide |
| PubChem CID | 89442092 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide |
| SMILES | C#CC1=CS(=O)CCC1 |
| InChI | InChI=1S/C7H8OS/c1-2-7-4-3-5-9(8)6-7/h1,6H,3-5H2 |
| InChIKey | UTEBKHFPZYOHDY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide?
The IUPAC name of 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide (CID 89442092) is 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide.
What is the SMILES notation for 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide?
The canonical SMILES for 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide is C#CC1=CS(=O)CCC1.
What is the InChIKey of 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide?
The InChIKey is UTEBKHFPZYOHDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS/c1-2-7-4-3-5-9(8)6-7/h1,6H,3-5H2.
What are the key properties of 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide?
5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide has a molecular weight of 140.21 g/mol, XLogP of 1.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-3,4-dihydro-2H-thiopyran 1-oxide is sourced from PubChem (CID 89442092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).