About 4-ethynyl-3-methyl-1,3-oxazinan-2-one
4-ethynyl-3-methyl-1,3-oxazinan-2-one (PubChem CID 89442280) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 4-ethynyl-3-methyl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 4-ethynyl-3-methyl-1,3-oxazinan-2-one |
| PubChem CID | 89442280 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 4-ethynyl-3-methyl-1,3-oxazinan-2-one |
| SMILES | C#CC1CCOC(=O)N1C |
| InChI | InChI=1S/C7H9NO2/c1-3-6-4-5-10-7(9)8(6)2/h1,6H,4-5H2,2H3 |
| InChIKey | QAVCYLNEHRCUEX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-3-methyl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-3-methyl-1,3-oxazinan-2-one?
The IUPAC name of 4-ethynyl-3-methyl-1,3-oxazinan-2-one (CID 89442280) is 4-ethynyl-3-methyl-1,3-oxazinan-2-one.
What is the SMILES notation for 4-ethynyl-3-methyl-1,3-oxazinan-2-one?
The canonical SMILES for 4-ethynyl-3-methyl-1,3-oxazinan-2-one is C#CC1CCOC(=O)N1C.
What is the InChIKey of 4-ethynyl-3-methyl-1,3-oxazinan-2-one?
The InChIKey is QAVCYLNEHRCUEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-3-6-4-5-10-7(9)8(6)2/h1,6H,4-5H2,2H3.
What are the key properties of 4-ethynyl-3-methyl-1,3-oxazinan-2-one?
4-ethynyl-3-methyl-1,3-oxazinan-2-one has a molecular weight of 139.15 g/mol, XLogP of 0.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-3-methyl-1,3-oxazinan-2-one is sourced from PubChem (CID 89442280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).