C15H20O — CID 89442362
(3E,5Z)-4-[[(2Z,4Z)-hepta-2,4,6-trienoxy]methyl]hepta-1,3,5-triene (PubChem CID 89442362) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (3E,5Z)-4-[[(2Z,4Z)-hepta-2,4,6-trienoxy]methyl]hepta-1,3,5-triene.
| Compound Name | (3E,5Z)-4-[[(2Z,4Z)-hepta-2,4,6-trienoxy]methyl]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 89442362 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (3E,5Z)-4-[[(2Z,4Z)-hepta-2,4,6-trienoxy]methyl]hepta-1,3,5-triene |
| SMILES | C=C/C=C\C=C/COCC(/C=C\C)=C/C=C |
| InChI | InChI=1S/C15H20O/c1-4-7-8-9-10-13-16-14-15(11-5-2)12-6-3/h4-12H,1-2,13-14H2,3H3/b8-7-,10-9-,12-6-,15-11+ |
| InChIKey | RYMOQPZKTMPAHK-JHKSUPOBSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|