C9H16N2 — CID 89442371
(7Z)-3,9-dimethyl-4,5,6,9-tetrahydro-1,3-diazonine (PubChem CID 89442371) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (7Z)-3,9-dimethyl-4,5,6,9-tetrahydro-1,3-diazonine.
| Compound Name | (7Z)-3,9-dimethyl-4,5,6,9-tetrahydro-1,3-diazonine |
|---|---|
| PubChem CID | 89442371 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (7Z)-3,9-dimethyl-4,5,6,9-tetrahydro-1,3-diazonine |
| SMILES | CC1/C=C\CCCN(C)/C=N\1 |
| InChI | InChI=1S/C9H16N2/c1-9-6-4-3-5-7-11(2)8-10-9/h4,6,8-9H,3,5,7H2,1-2H3/b6-4-,10-8- |
| InChIKey | CWAFOJZAEGZDGC-GKXDXITGSA-N |
| XLogP | 1.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|