C20H25F3N4O — CID 89442875
4-[1-[2-(azetidin-1-yl)ethyl]-4-[3-(trifluoromethoxy)phenyl]imidazol-2-yl]piperidine (PubChem CID 89442875) has the molecular formula C20H25F3N4O and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-[1-[2-(azetidin-1-yl)ethyl]-4-[3-(trifluoromethoxy)phenyl]imidazol-2-yl]piperidine.
| Compound Name | 4-[1-[2-(azetidin-1-yl)ethyl]-4-[3-(trifluoromethoxy)phenyl]imidazol-2-yl]piperidine |
|---|---|
| PubChem CID | 89442875 |
| Molecular Formula | C20H25F3N4O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-[1-[2-(azetidin-1-yl)ethyl]-4-[3-(trifluoromethoxy)phenyl]imidazol-2-yl]piperidine |
| SMILES | FC(F)(F)Oc1cccc(-c2cn(CCN3CCC3)c(C3CCNCC3)n2)c1 |
| InChI | InChI=1S/C20H25F3N4O/c21-20(22,23)28-17-4-1-3-16(13-17)18-14-27(12-11-26-9-2-10-26)19(25-18)15-5-7-24-8-6-15/h1,3-4,13-15,24H,2,5-12H2 |
| InChIKey | XFMUVTXBRKLRHN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |