C16H19N5O2S — CID 89443564
6-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 89443564) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 6-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 6-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 89443564 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 6-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | S=c1[nH]nc2ccc(-c3cnn(CCOC4CCCCO4)c3)cn12 |
| InChI | InChI=1S/C16H19N5O2S/c24-16-19-18-14-5-4-12(11-21(14)16)13-9-17-20(10-13)6-8-23-15-3-1-2-7-22-15/h4-5,9-11,15H,1-3,6-8H2,(H,19,24) |
| InChIKey | SQRJSZBELDGZHG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|