C6H3BrFN3S — CID 89443777
6-bromo-8-fluoro-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 89443777) has the molecular formula C6H3BrFN3S and a molecular weight of 248.08 g/mol. Its IUPAC name is 6-bromo-8-fluoro-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 6-bromo-8-fluoro-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 89443777 |
| Molecular Formula | C6H3BrFN3S |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.92 |
| IUPAC Name | 6-bromo-8-fluoro-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | Fc1cc(Br)cn2c(=S)[nH]nc12 |
| InChI | InChI=1S/C6H3BrFN3S/c7-3-1-4(8)5-9-10-6(12)11(5)2-3/h1-2H,(H,10,12) |
| InChIKey | OLSZRGKXBRJGEH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|