About 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol
2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol (PubChem CID 89443787) has the molecular formula C20H15F4NO
and a molecular weight of 361.34 g/mol. Its IUPAC name is 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol.
Molecular Properties
| Compound Name | 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol |
| PubChem CID | 89443787 |
| Molecular Formula | C20H15F4NO |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol |
| SMILES | Cc1c(F)cc(-c2cccc(F)c2)cc1N(C)c1c(F)ccc(O)c1F |
| InChI | InChI=1S/C20H15F4NO/c1-11-16(23)9-13(12-4-3-5-14(21)8-12)10-17(11)25(2)20-15(22)6-7-18(26)19(20)24/h3-10,26H,1-2H3 |
| InChIKey | LITBFFIVJAPZRA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol?
The IUPAC name of 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol (CID 89443787) is 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol.
What is the SMILES notation for 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol?
The canonical SMILES for 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol is Cc1c(F)cc(-c2cccc(F)c2)cc1N(C)c1c(F)ccc(O)c1F.
What is the InChIKey of 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol?
The InChIKey is LITBFFIVJAPZRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F4NO/c1-11-16(23)9-13(12-4-3-5-14(21)8-12)10-17(11)25(2)20-15(22)6-7-18(26)19(20)24/h3-10,26H,1-2H3.
What are the key properties of 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol?
2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol has a molecular weight of 361.34 g/mol, XLogP of 5.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-3-[3-fluoro-5-(3-fluorophenyl)-N,2-dimethylanilino]phenol is sourced from PubChem (CID 89443787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).