C18H19ClF3N3O3 — CID 89443852
5-(4-chlorophenyl)-2-(3-hydroxypropyl)-N'-methyl-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide (PubChem CID 89443852) has the molecular formula C18H19ClF3N3O3 and a molecular weight of 417.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(3-hydroxypropyl)-N'-methyl-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide.
| Compound Name | 5-(4-chlorophenyl)-2-(3-hydroxypropyl)-N'-methyl-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 89443852 |
| Molecular Formula | C18H19ClF3N3O3 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(3-hydroxypropyl)-N'-methyl-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide |
| SMILES | CNNC(=O)c1cc(-c2ccc(Cl)cc2)c(OCC(F)(F)F)nc1CCCO |
| InChI | InChI=1S/C18H19ClF3N3O3/c1-23-25-16(27)14-9-13(11-4-6-12(19)7-5-11)17(28-10-18(20,21)22)24-15(14)3-2-8-26/h4-7,9,23,26H,2-3,8,10H2,1H3,(H,25,27) |
| InChIKey | XQGYWJAREIMLSK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|