About 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol
3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol (PubChem CID 89443860) has the molecular formula C22H21F2NO
and a molecular weight of 353.41 g/mol. Its IUPAC name is 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol.
Molecular Properties
| Compound Name | 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol |
| PubChem CID | 89443860 |
| Molecular Formula | C22H21F2NO |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol |
| SMILES | Cc1cc(CNc2c(C)ccc(O)c2C)c(F)c(-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C22H21F2NO/c1-13-9-17(12-25-22-14(2)7-8-20(26)15(22)3)21(24)19(10-13)16-5-4-6-18(23)11-16/h4-11,25-26H,12H2,1-3H3 |
| InChIKey | OEMCALBWZJVHIX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol?
The IUPAC name of 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol (CID 89443860) is 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol.
What is the SMILES notation for 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol?
The canonical SMILES for 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol is Cc1cc(CNc2c(C)ccc(O)c2C)c(F)c(-c2cccc(F)c2)c1.
What is the InChIKey of 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol?
The InChIKey is OEMCALBWZJVHIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F2NO/c1-13-9-17(12-25-22-14(2)7-8-20(26)15(22)3)21(24)19(10-13)16-5-4-6-18(23)11-16/h4-11,25-26H,12H2,1-3H3.
What are the key properties of 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol?
3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol has a molecular weight of 353.41 g/mol, XLogP of 5.87, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-fluoro-3-(3-fluorophenyl)-5-methylphenyl]methylamino]-2,4-dimethylphenol is sourced from PubChem (CID 89443860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).