C14H8ClF3I2N2O5 — CID 89444081
6-chloro-5-iodopyridine-3-carboxylic acid;5-iodo-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid (PubChem CID 89444081) has the molecular formula C14H8ClF3I2N2O5 and a molecular weight of 630.48 g/mol. Its IUPAC name is 6-chloro-5-iodopyridine-3-carboxylic acid;5-iodo-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-5-iodopyridine-3-carboxylic acid;5-iodo-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 89444081 |
| Molecular Formula | C14H8ClF3I2N2O5 |
| Molecular Weight | 630.48 g/mol |
| Exact Mass | 629.82 |
| IUPAC Name | 6-chloro-5-iodopyridine-3-carboxylic acid;5-iodo-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(Cl)c(I)c1.O=C(O)c1cnc(OCC(F)(F)F)c(I)c1 |
| InChI | InChI=1S/C8H5F3INO3.C6H3ClINO2/c9-8(10,11)3-16-6-5(12)1-4(2-13-6)7(14)15;7-5-4(8)1-3(2-9-5)6(10)11/h1-2H,3H2,(H,14,15);1-2H,(H,10,11) |
| InChIKey | BAVNTOBNKLHDFP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|