About 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol
3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol (PubChem CID 89444095) has the molecular formula C21H19F2NO
and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol.
Molecular Properties
| Compound Name | 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol |
| PubChem CID | 89444095 |
| Molecular Formula | C21H19F2NO |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol |
| SMILES | Cc1cc(-c2ccccc2)cc(CNc2c(F)ccc(O)c2F)c1C |
| InChI | InChI=1S/C21H19F2NO/c1-13-10-16(15-6-4-3-5-7-15)11-17(14(13)2)12-24-21-18(22)8-9-19(25)20(21)23/h3-11,24-25H,12H2,1-2H3 |
| InChIKey | BJCSSFZSOBLOCB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol?
The IUPAC name of 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol (CID 89444095) is 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol.
What is the SMILES notation for 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol?
The canonical SMILES for 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol is Cc1cc(-c2ccccc2)cc(CNc2c(F)ccc(O)c2F)c1C.
What is the InChIKey of 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol?
The InChIKey is BJCSSFZSOBLOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2NO/c1-13-10-16(15-6-4-3-5-7-15)11-17(14(13)2)12-24-21-18(22)8-9-19(25)20(21)23/h3-11,24-25H,12H2,1-2H3.
What are the key properties of 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol?
3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol has a molecular weight of 339.39 g/mol, XLogP of 5.57, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-dimethyl-5-phenylphenyl)methylamino]-2,4-difluorophenol is sourced from PubChem (CID 89444095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).