About propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate
propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate (PubChem CID 89444122) has the molecular formula C19H20BrF2NO3
and a molecular weight of 428.27 g/mol. Its IUPAC name is propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate |
| PubChem CID | 89444122 |
| Molecular Formula | C19H20BrF2NO3 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate |
| SMILES | Cc1cc(Br)cc(N(C)c2c(F)ccc(OCC(=O)OC(C)C)c2F)c1 |
| InChI | InChI=1S/C19H20BrF2NO3/c1-11(2)26-17(24)10-25-16-6-5-15(21)19(18(16)22)23(4)14-8-12(3)7-13(20)9-14/h5-9,11H,10H2,1-4H3 |
| InChIKey | MYNXUTHVTWJSRO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate?
The IUPAC name of propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate (CID 89444122) is propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate.
What is the SMILES notation for propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate?
The canonical SMILES for propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate is Cc1cc(Br)cc(N(C)c2c(F)ccc(OCC(=O)OC(C)C)c2F)c1.
What is the InChIKey of propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate?
The InChIKey is MYNXUTHVTWJSRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20BrF2NO3/c1-11(2)26-17(24)10-25-16-6-5-15(21)19(18(16)22)23(4)14-8-12(3)7-13(20)9-14/h5-9,11H,10H2,1-4H3.
What are the key properties of propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate?
propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate has a molecular weight of 428.27 g/mol, XLogP of 5.13, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[3-(3-bromo-N,5-dimethylanilino)-2,4-difluorophenoxy]acetate is sourced from PubChem (CID 89444122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).