C21H14Cl3F3N2O2S2 — CID 89444423
2-methyl-N-(2-oxothietan-3-yl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzamide (PubChem CID 89444423) has the molecular formula C21H14Cl3F3N2O2S2 and a molecular weight of 553.84 g/mol. Its IUPAC name is 2-methyl-N-(2-oxothietan-3-yl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzamide.
| Compound Name | 2-methyl-N-(2-oxothietan-3-yl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 89444423 |
| Molecular Formula | C21H14Cl3F3N2O2S2 |
| Molecular Weight | 553.84 g/mol |
| Exact Mass | 551.95 |
| IUPAC Name | 2-methyl-N-(2-oxothietan-3-yl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]benzamide |
| SMILES | Cc1cc(C2=NSC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NC1CSC1=O |
| InChI | InChI=1S/C21H14Cl3F3N2O2S2/c1-9-4-10(2-3-12(9)18(30)28-16-8-32-19(16)31)15-7-20(33-29-15,21(25,26)27)11-5-13(22)17(24)14(23)6-11/h2-6,16H,7-8H2,1H3,(H,28,30) |
| InChIKey | XJKRBXNYWPLHDB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.84 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|