C23H21ClFNO4S — CID 89444470
1-[[2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]methyl]-3,4-dihydro-2H-quinoline-5-sulfonic acid (PubChem CID 89444470) has the molecular formula C23H21ClFNO4S and a molecular weight of 461.94 g/mol. Its IUPAC name is 1-[[2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]methyl]-3,4-dihydro-2H-quinoline-5-sulfonic acid.
| Compound Name | 1-[[2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]methyl]-3,4-dihydro-2H-quinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 89444470 |
| Molecular Formula | C23H21ClFNO4S |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 1-[[2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]methyl]-3,4-dihydro-2H-quinoline-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1cccc2c1CCCN2Cc1ccccc1OCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C23H21ClFNO4S/c24-18-11-10-17(20(25)13-18)15-30-22-8-2-1-5-16(22)14-26-12-4-6-19-21(26)7-3-9-23(19)31(27,28)29/h1-3,5,7-11,13H,4,6,12,14-15H2,(H,27,28,29) |
| InChIKey | BJJXVHBRESUKHJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|