C23H20ClF2NO4S — CID 89444529
1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3,4-dihydro-2H-quinoline-5-sulfonic acid (PubChem CID 89444529) has the molecular formula C23H20ClF2NO4S and a molecular weight of 479.93 g/mol. Its IUPAC name is 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3,4-dihydro-2H-quinoline-5-sulfonic acid.
| Compound Name | 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3,4-dihydro-2H-quinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 89444529 |
| Molecular Formula | C23H20ClF2NO4S |
| Molecular Weight | 479.93 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3,4-dihydro-2H-quinoline-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1cccc2c1CCCN2Cc1cc(Cl)ccc1OCc1ccc(F)cc1F |
| InChI | InChI=1S/C23H20ClF2NO4S/c24-17-7-9-22(31-14-15-6-8-18(25)12-20(15)26)16(11-17)13-27-10-2-3-19-21(27)4-1-5-23(19)32(28,29)30/h1,4-9,11-12H,2-3,10,13-14H2,(H,28,29,30) |
| InChIKey | HUJYRRAXSPBSHF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.93 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|