C20H18ClNO4 — CID 89444723
1-[(5-chloro-2-cyclobutyloxyphenyl)methyl]-2-oxo-3H-indole-4-carboxylic acid (PubChem CID 89444723) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is 1-[(5-chloro-2-cyclobutyloxyphenyl)methyl]-2-oxo-3H-indole-4-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-cyclobutyloxyphenyl)methyl]-2-oxo-3H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 89444723 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-[(5-chloro-2-cyclobutyloxyphenyl)methyl]-2-oxo-3H-indole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1CC(=O)N2Cc1cc(Cl)ccc1OC1CCC1 |
| InChI | InChI=1S/C20H18ClNO4/c21-13-7-8-18(26-14-3-1-4-14)12(9-13)11-22-17-6-2-5-15(20(24)25)16(17)10-19(22)23/h2,5-9,14H,1,3-4,10-11H2,(H,24,25) |
| InChIKey | DYAZGRLKOVMFRG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |