C17H19F3N4S — CID 89445156
10,12-dimethyl-N-[4-(trifluoromethyl)cyclohexyl]-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 89445156) has the molecular formula C17H19F3N4S and a molecular weight of 368.43 g/mol. Its IUPAC name is 10,12-dimethyl-N-[4-(trifluoromethyl)cyclohexyl]-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | 10,12-dimethyl-N-[4-(trifluoromethyl)cyclohexyl]-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 89445156 |
| Molecular Formula | C17H19F3N4S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 10,12-dimethyl-N-[4-(trifluoromethyl)cyclohexyl]-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | Cc1cc(C)c2c(n1)sc1c(NC3CCC(C(F)(F)F)CC3)n[nH]c12 |
| InChI | InChI=1S/C17H19F3N4S/c1-8-7-9(2)21-16-12(8)13-14(25-16)15(24-23-13)22-11-5-3-10(4-6-11)17(18,19)20/h7,10-11H,3-6H2,1-2H3,(H2,22,23,24) |
| InChIKey | SFERQNZOOMEVMJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |