C17H15FN4S — CID 89445225
N-[(4-fluorophenyl)methyl]-10,12-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 89445225) has the molecular formula C17H15FN4S and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-10,12-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-10,12-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 89445225 |
| Molecular Formula | C17H15FN4S |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-10,12-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | Cc1cc(C)c2c(n1)sc1c(NCc3ccc(F)cc3)n[nH]c12 |
| InChI | InChI=1S/C17H15FN4S/c1-9-7-10(2)20-17-13(9)14-15(23-17)16(22-21-14)19-8-11-3-5-12(18)6-4-11/h3-7H,8H2,1-2H3,(H2,19,21,22) |
| InChIKey | WQPKTEURTODEER-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |