C15H18N4OS — CID 89445287
10,12-dimethyl-N-(oxan-4-yl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 89445287) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 10,12-dimethyl-N-(oxan-4-yl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | 10,12-dimethyl-N-(oxan-4-yl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 89445287 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 10,12-dimethyl-N-(oxan-4-yl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | Cc1cc(C)c2c(n1)sc1c(NC3CCOCC3)n[nH]c12 |
| InChI | InChI=1S/C15H18N4OS/c1-8-7-9(2)16-15-11(8)12-13(21-15)14(19-18-12)17-10-3-5-20-6-4-10/h7,10H,3-6H2,1-2H3,(H2,17,18,19) |
| InChIKey | FZUFQZYHEUEBBV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |