About 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid
3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 89445335) has the molecular formula C17H19F3N2O4
and a molecular weight of 372.34 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid |
| PubChem CID | 89445335 |
| Molecular Formula | C17H19F3N2O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | COCCOc1nc(C(=O)O)c(-n2c(C)ccc2C)c(C)c1C(F)(F)F |
| InChI | InChI=1S/C17H19F3N2O4/c1-9-5-6-10(2)22(9)14-11(3)12(17(18,19)20)15(26-8-7-25-4)21-13(14)16(23)24/h5-6H,7-8H2,1-4H3,(H,23,24) |
| InChIKey | GRHDEBLJFFGBKR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid?
The IUPAC name of 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid (CID 89445335) is 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid?
The canonical SMILES for 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid is COCCOc1nc(C(=O)O)c(-n2c(C)ccc2C)c(C)c1C(F)(F)F.
What is the InChIKey of 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid?
The InChIKey is GRHDEBLJFFGBKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3N2O4/c1-9-5-6-10(2)22(9)14-11(3)12(17(18,19)20)15(26-8-7-25-4)21-13(14)16(23)24/h5-6H,7-8H2,1-4H3,(H,23,24).
What are the key properties of 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid?
3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid has a molecular weight of 372.34 g/mol, XLogP of 3.54, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylpyrrol-1-yl)-6-(2-methoxyethoxy)-4-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 89445335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).