C19H10Cl2F3N5S — CID 89445354
5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-(1,2,4-triazol-1-yl)benzonitrile (PubChem CID 89445354) has the molecular formula C19H10Cl2F3N5S and a molecular weight of 468.29 g/mol. Its IUPAC name is 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-(1,2,4-triazol-1-yl)benzonitrile.
| Compound Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-(1,2,4-triazol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 89445354 |
| Molecular Formula | C19H10Cl2F3N5S |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-2-(1,2,4-triazol-1-yl)benzonitrile |
| SMILES | N#Cc1cc(C2=NSC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1-n1cncn1 |
| InChI | InChI=1S/C19H10Cl2F3N5S/c20-14-4-13(5-15(21)6-14)18(19(22,23)24)7-16(28-30-18)11-1-2-17(12(3-11)8-25)29-10-26-9-27-29/h1-6,9-10H,7H2 |
| InChIKey | LBIXLLWZLFGMMC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 66.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|