C20H18FN3O6S2 — CID 89445452
4-(2,3-dihydro-1,4-benzodioxin-5-yl)-5-fluoro-N-[3-(methylsulfonylsulfonylmethyl)phenyl]pyrimidin-2-amine (PubChem CID 89445452) has the molecular formula C20H18FN3O6S2 and a molecular weight of 479.51 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-5-yl)-5-fluoro-N-[3-(methylsulfonylsulfonylmethyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-5-yl)-5-fluoro-N-[3-(methylsulfonylsulfonylmethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 89445452 |
| Molecular Formula | C20H18FN3O6S2 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-5-yl)-5-fluoro-N-[3-(methylsulfonylsulfonylmethyl)phenyl]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)S(=O)(=O)Cc1cccc(Nc2ncc(F)c(-c3cccc4c3OCCO4)n2)c1 |
| InChI | InChI=1S/C20H18FN3O6S2/c1-31(25,26)32(27,28)12-13-4-2-5-14(10-13)23-20-22-11-16(21)18(24-20)15-6-3-7-17-19(15)30-9-8-29-17/h2-7,10-11H,8-9,12H2,1H3,(H,22,23,24) |
| InChIKey | JQRUUPTUMVXBKC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|