C22H18N6O2 — CID 89445547
5-[5-(cyclopropanecarbonylamino)-3-pyridinyl]-N-pyridin-3-yl-1H-indazole-3-carboxamide (PubChem CID 89445547) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 5-[5-(cyclopropanecarbonylamino)-3-pyridinyl]-N-pyridin-3-yl-1H-indazole-3-carboxamide.
| Compound Name | 5-[5-(cyclopropanecarbonylamino)-3-pyridinyl]-N-pyridin-3-yl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 89445547 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 5-[5-(cyclopropanecarbonylamino)-3-pyridinyl]-N-pyridin-3-yl-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1n[nH]c2ccc(-c3cncc(NC(=O)C4CC4)c3)cc12 |
| InChI | InChI=1S/C22H18N6O2/c29-21(13-3-4-13)26-17-8-15(10-24-12-17)14-5-6-19-18(9-14)20(28-27-19)22(30)25-16-2-1-7-23-11-16/h1-2,5-13H,3-4H2,(H,25,30)(H,26,29)(H,27,28) |
| InChIKey | LIYYADOUOVYBID-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |