About 5-ethynyl-4-methyltrithiane 2-oxide
5-ethynyl-4-methyltrithiane 2-oxide (PubChem CID 89446225) has the molecular formula C6H8OS3
and a molecular weight of 192.33 g/mol. Its IUPAC name is 5-ethynyl-4-methyltrithiane 2-oxide.
Molecular Properties
| Compound Name | 5-ethynyl-4-methyltrithiane 2-oxide |
| PubChem CID | 89446225 |
| Molecular Formula | C6H8OS3 |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 191.97 |
| IUPAC Name | 5-ethynyl-4-methyltrithiane 2-oxide |
| SMILES | C#CC1CSS(=O)SC1C |
| InChI | InChI=1S/C6H8OS3/c1-3-6-4-8-10(7)9-5(6)2/h1,5-6H,4H2,2H3 |
| InChIKey | LMDPMKDQVJJSER-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-4-methyltrithiane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-4-methyltrithiane 2-oxide?
The IUPAC name of 5-ethynyl-4-methyltrithiane 2-oxide (CID 89446225) is 5-ethynyl-4-methyltrithiane 2-oxide.
What is the SMILES notation for 5-ethynyl-4-methyltrithiane 2-oxide?
The canonical SMILES for 5-ethynyl-4-methyltrithiane 2-oxide is C#CC1CSS(=O)SC1C.
What is the InChIKey of 5-ethynyl-4-methyltrithiane 2-oxide?
The InChIKey is LMDPMKDQVJJSER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OS3/c1-3-6-4-8-10(7)9-5(6)2/h1,5-6H,4H2,2H3.
What are the key properties of 5-ethynyl-4-methyltrithiane 2-oxide?
5-ethynyl-4-methyltrithiane 2-oxide has a molecular weight of 192.33 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-4-methyltrithiane 2-oxide is sourced from PubChem (CID 89446225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).