C8H13N2OP — CID 89446295
4-ethynyl-N,N,1-trimethyl-2-oxo-5H-1,2λ5-azaphosphol-2-amine (PubChem CID 89446295) has the molecular formula C8H13N2OP and a molecular weight of 184.18 g/mol. Its IUPAC name is 4-ethynyl-N,N,1-trimethyl-2-oxo-5H-1,2λ5-azaphosphol-2-amine.
| Compound Name | 4-ethynyl-N,N,1-trimethyl-2-oxo-5H-1,2λ5-azaphosphol-2-amine |
|---|---|
| PubChem CID | 89446295 |
| Molecular Formula | C8H13N2OP |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 4-ethynyl-N,N,1-trimethyl-2-oxo-5H-1,2λ5-azaphosphol-2-amine |
| SMILES | C#CC1=CP(=O)(N(C)C)N(C)C1 |
| InChI | InChI=1S/C8H13N2OP/c1-5-8-6-10(4)12(11,7-8)9(2)3/h1,7H,6H2,2-4H3 |
| InChIKey | LZBSHUOEKDMBBV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|