C8H10N2O2S — CID 89446414
3,4-diethynyl-2,5-dimethyl-1,2,5-thiadiazolidine 1,1-dioxide (PubChem CID 89446414) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 3,4-diethynyl-2,5-dimethyl-1,2,5-thiadiazolidine 1,1-dioxide.
| Compound Name | 3,4-diethynyl-2,5-dimethyl-1,2,5-thiadiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 89446414 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 3,4-diethynyl-2,5-dimethyl-1,2,5-thiadiazolidine 1,1-dioxide |
| SMILES | C#CC1C(C#C)N(C)S(=O)(=O)N1C |
| InChI | InChI=1S/C8H10N2O2S/c1-5-7-8(6-2)10(4)13(11,12)9(7)3/h1-2,7-8H,3-4H3 |
| InChIKey | VUJUERSHYIBPHI-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|