C8H10N2S2 — CID 89446632
3,4-diethynyl-2,5-dimethyl-1-sulfanylidene-1,2,5-thiadiazolidine (PubChem CID 89446632) has the molecular formula C8H10N2S2 and a molecular weight of 198.32 g/mol. Its IUPAC name is 3,4-diethynyl-2,5-dimethyl-1-sulfanylidene-1,2,5-thiadiazolidine.
| Compound Name | 3,4-diethynyl-2,5-dimethyl-1-sulfanylidene-1,2,5-thiadiazolidine |
|---|---|
| PubChem CID | 89446632 |
| Molecular Formula | C8H10N2S2 |
| Molecular Weight | 198.32 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 3,4-diethynyl-2,5-dimethyl-1-sulfanylidene-1,2,5-thiadiazolidine |
| SMILES | C#CC1C(C#C)N(C)S(=S)N1C |
| InChI | InChI=1S/C8H10N2S2/c1-5-7-8(6-2)10(4)12(11)9(7)3/h1-2,7-8H,3-4H3 |
| InChIKey | SJMMOBAOYRPUMP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|