C22H25FN6 — CID 89446774
6-[4-(2-amino-1-phenylethyl)piperazin-1-yl]-5-(4-fluorophenyl)pyrimidin-4-amine (PubChem CID 89446774) has the molecular formula C22H25FN6 and a molecular weight of 392.48 g/mol. Its IUPAC name is 6-[4-(2-amino-1-phenylethyl)piperazin-1-yl]-5-(4-fluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-[4-(2-amino-1-phenylethyl)piperazin-1-yl]-5-(4-fluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 89446774 |
| Molecular Formula | C22H25FN6 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 6-[4-(2-amino-1-phenylethyl)piperazin-1-yl]-5-(4-fluorophenyl)pyrimidin-4-amine |
| SMILES | NCC(c1ccccc1)N1CCN(c2ncnc(N)c2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H25FN6/c23-18-8-6-17(7-9-18)20-21(25)26-15-27-22(20)29-12-10-28(11-13-29)19(14-24)16-4-2-1-3-5-16/h1-9,15,19H,10-14,24H2,(H2,25,26,27) |
| InChIKey | DIAQYSLZMGCMGJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |