About 3,4,5-tritert-butyl-1,3-thiazol-2-one
3,4,5-tritert-butyl-1,3-thiazol-2-one (PubChem CID 89447010) has the molecular formula C15H27NOS
and a molecular weight of 269.45 g/mol. Its IUPAC name is 3,4,5-tritert-butyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3,4,5-tritert-butyl-1,3-thiazol-2-one |
| PubChem CID | 89447010 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 3,4,5-tritert-butyl-1,3-thiazol-2-one |
| SMILES | CC(C)(C)c1sc(=O)n(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C15H27NOS/c1-13(2,3)10-11(14(4,5)6)18-12(17)16(10)15(7,8)9/h1-9H3 |
| InChIKey | HJALMOPOVUBYIY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4,5-tritert-butyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-tritert-butyl-1,3-thiazol-2-one?
The IUPAC name of 3,4,5-tritert-butyl-1,3-thiazol-2-one (CID 89447010) is 3,4,5-tritert-butyl-1,3-thiazol-2-one.
What is the SMILES notation for 3,4,5-tritert-butyl-1,3-thiazol-2-one?
The canonical SMILES for 3,4,5-tritert-butyl-1,3-thiazol-2-one is CC(C)(C)c1sc(=O)n(C(C)(C)C)c1C(C)(C)C.
What is the InChIKey of 3,4,5-tritert-butyl-1,3-thiazol-2-one?
The InChIKey is HJALMOPOVUBYIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NOS/c1-13(2,3)10-11(14(4,5)6)18-12(17)16(10)15(7,8)9/h1-9H3.
What are the key properties of 3,4,5-tritert-butyl-1,3-thiazol-2-one?
3,4,5-tritert-butyl-1,3-thiazol-2-one has a molecular weight of 269.45 g/mol, XLogP of 4.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-tritert-butyl-1,3-thiazol-2-one is sourced from PubChem (CID 89447010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).