C25H30N6O2 — CID 89447047
N-[3,5-bis(trideuteriomethoxy)phenyl]-1,1,2,2-tetradeuterio-N-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 89447047) has the molecular formula C25H30N6O2 and a molecular weight of 456.62 g/mol. Its IUPAC name is N-[3,5-bis(trideuteriomethoxy)phenyl]-1,1,2,2-tetradeuterio-N-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-[3,5-bis(trideuteriomethoxy)phenyl]-1,1,2,2-tetradeuterio-N-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 89447047 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | N-[3,5-bis(trideuteriomethoxy)phenyl]-1,1,2,2-tetradeuterio-N-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | [2H]C([2H])([2H])Oc1cc(OC([2H])([2H])[2H])cc(N(c2ccc3ncc(-c4cnn(C)c4)nc3c2)C([2H])([2H])C([2H])([2H])NC(C)C)c1 |
| InChI | InChI=1S/C25H30N6O2/c1-17(2)26-8-9-31(20-10-21(32-4)13-22(11-20)33-5)19-6-7-23-24(12-19)29-25(15-27-23)18-14-28-30(3)16-18/h6-7,10-17,26H,8-9H2,1-5H3/i4D3,5D3,8D2,9D2 |
| InChIKey | OLAHOMJCDNXHFI-RCEBUFFYSA-N |
| XLogP | 4.18 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |