About N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine
N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine (PubChem CID 89447081) has the molecular formula C22H23N5O2
and a molecular weight of 389.46 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine.
Molecular Properties
| Compound Name | N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine |
| PubChem CID | 89447081 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine |
| SMILES | CCN(c1cc(OC)cc(OC)c1)c1ccc2ncc(-c3cnn(C)c3)nc2c1 |
| InChI | InChI=1S/C22H23N5O2/c1-5-27(17-8-18(28-3)11-19(9-17)29-4)16-6-7-20-21(10-16)25-22(13-23-20)15-12-24-26(2)14-15/h6-14H,5H2,1-4H3 |
| InChIKey | YPAFPGOEBJGULD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine?
The IUPAC name of N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine (CID 89447081) is N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine.
What is the SMILES notation for N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine?
The canonical SMILES for N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine is CCN(c1cc(OC)cc(OC)c1)c1ccc2ncc(-c3cnn(C)c3)nc2c1.
What is the InChIKey of N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine?
The InChIKey is YPAFPGOEBJGULD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5O2/c1-5-27(17-8-18(28-3)11-19(9-17)29-4)16-6-7-20-21(10-16)25-22(13-23-20)15-12-24-26(2)14-15/h6-14H,5H2,1-4H3.
What are the key properties of N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine?
N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine has a molecular weight of 389.46 g/mol, XLogP of 4.21, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethoxyphenyl)-N-ethyl-3-(1-methylpyrazol-4-yl)quinoxalin-6-amine is sourced from PubChem (CID 89447081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).