About 2,5-ditert-butylfuro[2,3-b]furan
2,5-ditert-butylfuro[2,3-b]furan (PubChem CID 89447163) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,5-ditert-butylfuro[2,3-b]furan.
Molecular Properties
| Compound Name | 2,5-ditert-butylfuro[2,3-b]furan |
| PubChem CID | 89447163 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,5-ditert-butylfuro[2,3-b]furan |
| SMILES | CC(C)(C)c1cc2cc(C(C)(C)C)oc2o1 |
| InChI | InChI=1S/C14H20O2/c1-13(2,3)10-7-9-8-11(14(4,5)6)16-12(9)15-10/h7-8H,1-6H3 |
| InChIKey | BELHEGXLNMRQSX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-ditert-butylfuro[2,3-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butylfuro[2,3-b]furan?
The IUPAC name of 2,5-ditert-butylfuro[2,3-b]furan (CID 89447163) is 2,5-ditert-butylfuro[2,3-b]furan.
What is the SMILES notation for 2,5-ditert-butylfuro[2,3-b]furan?
The canonical SMILES for 2,5-ditert-butylfuro[2,3-b]furan is CC(C)(C)c1cc2cc(C(C)(C)C)oc2o1.
What is the InChIKey of 2,5-ditert-butylfuro[2,3-b]furan?
The InChIKey is BELHEGXLNMRQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-13(2,3)10-7-9-8-11(14(4,5)6)16-12(9)15-10/h7-8H,1-6H3.
What are the key properties of 2,5-ditert-butylfuro[2,3-b]furan?
2,5-ditert-butylfuro[2,3-b]furan has a molecular weight of 220.31 g/mol, XLogP of 4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butylfuro[2,3-b]furan is sourced from PubChem (CID 89447163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).