C56H70N2OS2 — CID 89447972
2-(4-butoxyphenyl)-3-(4-butylphenyl)-8-methyl-5-(7-methyl-4,5-dioctylthieno[3,2-g][1]benzothiol-2-yl)quinoxaline (PubChem CID 89447972) has the molecular formula C56H70N2OS2 and a molecular weight of 851.32 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-3-(4-butylphenyl)-8-methyl-5-(7-methyl-4,5-dioctylthieno[3,2-g][1]benzothiol-2-yl)quinoxaline.
| Compound Name | 2-(4-butoxyphenyl)-3-(4-butylphenyl)-8-methyl-5-(7-methyl-4,5-dioctylthieno[3,2-g][1]benzothiol-2-yl)quinoxaline |
|---|---|
| PubChem CID | 89447972 |
| Molecular Formula | C56H70N2OS2 |
| Molecular Weight | 851.32 g/mol |
| Exact Mass | 850.49 |
| IUPAC Name | 2-(4-butoxyphenyl)-3-(4-butylphenyl)-8-methyl-5-(7-methyl-4,5-dioctylthieno[3,2-g][1]benzothiol-2-yl)quinoxaline |
| SMILES | CCCCCCCCc1c(CCCCCCCC)c2cc(-c3ccc(C)c4nc(-c5ccc(OCCCC)cc5)c(-c5ccc(CCCC)cc5)nc34)sc2c2sc(C)cc12 |
| InChI | InChI=1S/C56H70N2OS2/c1-7-11-15-17-19-21-24-45-46(25-22-20-18-16-12-8-2)49-38-50(61-56(49)55-48(45)37-40(6)60-55)47-35-26-39(5)51-54(47)58-53(42-29-27-41(28-30-42)23-13-9-3)52(57-51)43-31-33-44(34-32-43)59-36-14-10-4/h26-35,37-38H,7-25,36H2,1-6H3 |
| InChIKey | NPEDVDRNXLSBMN-UHFFFAOYSA-N |
| XLogP | 18.00 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.32 |
| LogP ≤ 5 | 18.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|