C20H20ClN3O3 — CID 8944812
[(2S)-4-(6-chloropyridine-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-2-yl]-piperidin-1-ylmethanone (PubChem CID 8944812) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is [(2S)-4-(6-chloropyridine-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [(2S)-4-(6-chloropyridine-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 8944812 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [(2S)-4-(6-chloropyridine-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-2-yl]-piperidin-1-ylmethanone |
| SMILES | O=C([C@@H]1CN(C(=O)c2ccc(Cl)nc2)c2ccccc2O1)N1CCCCC1 |
| InChI | InChI=1S/C20H20ClN3O3/c21-18-9-8-14(12-22-18)19(25)24-13-17(20(26)23-10-4-1-5-11-23)27-16-7-3-2-6-15(16)24/h2-3,6-9,12,17H,1,4-5,10-11,13H2/t17-/m0/s1 |
| InChIKey | SOUWKEPYECWBNP-KRWDZBQOSA-N |
| XLogP | 3.16 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|