C18H23BrN2O4 — CID 8944836
3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 8944836) has the molecular formula C18H23BrN2O4 and a molecular weight of 411.30 g/mol. Its IUPAC name is 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 8944836 |
| Molecular Formula | C18H23BrN2O4 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | COc1cc(Br)c(CN2C(=O)NC3(CCCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C18H23BrN2O4/c1-24-14-9-12(13(19)10-15(14)25-2)11-21-16(22)18(20-17(21)23)7-5-3-4-6-8-18/h9-10H,3-8,11H2,1-2H3,(H,20,23) |
| InChIKey | WYXJUFBWYOLOSY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|