About 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole
4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole (PubChem CID 89448846) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole.
Molecular Properties
| Compound Name | 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole |
| PubChem CID | 89448846 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole |
| SMILES | CC1=CC=C(c2ccc(C)cc2)C2OCOC12 |
| InChI | InChI=1S/C15H16O2/c1-10-3-6-12(7-4-10)13-8-5-11(2)14-15(13)17-9-16-14/h3-8,14-15H,9H2,1-2H3 |
| InChIKey | BZPMCJVKIFSIKB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole?
The IUPAC name of 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole (CID 89448846) is 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole.
What is the SMILES notation for 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole?
The canonical SMILES for 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole is CC1=CC=C(c2ccc(C)cc2)C2OCOC12.
What is the InChIKey of 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole?
The InChIKey is BZPMCJVKIFSIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-10-3-6-12(7-4-10)13-8-5-11(2)14-15(13)17-9-16-14/h3-8,14-15H,9H2,1-2H3.
What are the key properties of 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole?
4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole has a molecular weight of 228.29 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-7-(4-methylphenyl)-3a,7a-dihydro-1,3-benzodioxole is sourced from PubChem (CID 89448846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).