C17H26BNO2 — CID 89449024
(3R)-3-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine (PubChem CID 89449024) has the molecular formula C17H26BNO2 and a molecular weight of 287.21 g/mol. Its IUPAC name is (3R)-3-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine.
| Compound Name | (3R)-3-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 89449024 |
| Molecular Formula | C17H26BNO2 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | (3R)-3-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
| SMILES | C[C@@H]1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C17H26BNO2/c1-13-10-11-19(12-13)15-8-6-14(7-9-15)18-20-16(2,3)17(4,5)21-18/h6-9,13H,10-12H2,1-5H3/t13-/m1/s1 |
| InChIKey | AUDORBDNIALMKS-CYBMUJFWSA-N |
| XLogP | 2.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|