About [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate
[(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate (PubChem CID 89449209) has the molecular formula C30H32N2O2S
and a molecular weight of 484.67 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate.
Molecular Properties
| Compound Name | [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate |
| PubChem CID | 89449209 |
| Molecular Formula | C30H32N2O2S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate |
| SMILES | CCC(CC)c1ccc(-c2ccc(-c3snc(C)c3NC(=O)O[C@H](C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H32N2O2S/c1-5-22(6-2)24-12-14-25(15-13-24)26-16-18-27(19-17-26)29-28(20(3)32-35-29)31-30(33)34-21(4)23-10-8-7-9-11-23/h7-19,21-22H,5-6H2,1-4H3,(H,31,33)/t21-/m1/s1 |
| InChIKey | HQJQCRKIJDKZTK-OAQYLSRUSA-N |
| XLogP | 9.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate?
The IUPAC name of [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate (CID 89449209) is [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate.
What is the SMILES notation for [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate?
The canonical SMILES for [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate is CCC(CC)c1ccc(-c2ccc(-c3snc(C)c3NC(=O)O[C@H](C)c3ccccc3)cc2)cc1.
What is the InChIKey of [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate?
The InChIKey is HQJQCRKIJDKZTK-OAQYLSRUSA-N. The full InChI is InChI=1S/C30H32N2O2S/c1-5-22(6-2)24-12-14-25(15-13-24)26-16-18-27(19-17-26)29-28(20(3)32-35-29)31-30(33)34-21(4)23-10-8-7-9-11-23/h7-19,21-22H,5-6H2,1-4H3,(H,31,33)/t21-/m1/s1.
What are the key properties of [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate?
[(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate has a molecular weight of 484.67 g/mol, XLogP of 9.00, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-phenylethyl] N-[3-methyl-5-[4-(4-pentan-3-ylphenyl)phenyl]-1,2-thiazol-4-yl]carbamate is sourced from PubChem (CID 89449209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).