About 5-methylidene-2,3-di(propan-2-yl)pyrrole
5-methylidene-2,3-di(propan-2-yl)pyrrole (PubChem CID 89449382) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 5-methylidene-2,3-di(propan-2-yl)pyrrole.
Molecular Properties
| Compound Name | 5-methylidene-2,3-di(propan-2-yl)pyrrole |
| PubChem CID | 89449382 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 5-methylidene-2,3-di(propan-2-yl)pyrrole |
| SMILES | C=C1C=C(C(C)C)C(C(C)C)=N1 |
| InChI | InChI=1S/C11H17N/c1-7(2)10-6-9(5)12-11(10)8(3)4/h6-8H,5H2,1-4H3 |
| InChIKey | YVYCOFFBONDBHW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methylidene-2,3-di(propan-2-yl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidene-2,3-di(propan-2-yl)pyrrole?
The IUPAC name of 5-methylidene-2,3-di(propan-2-yl)pyrrole (CID 89449382) is 5-methylidene-2,3-di(propan-2-yl)pyrrole.
What is the SMILES notation for 5-methylidene-2,3-di(propan-2-yl)pyrrole?
The canonical SMILES for 5-methylidene-2,3-di(propan-2-yl)pyrrole is C=C1C=C(C(C)C)C(C(C)C)=N1.
What is the InChIKey of 5-methylidene-2,3-di(propan-2-yl)pyrrole?
The InChIKey is YVYCOFFBONDBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-7(2)10-6-9(5)12-11(10)8(3)4/h6-8H,5H2,1-4H3.
What are the key properties of 5-methylidene-2,3-di(propan-2-yl)pyrrole?
5-methylidene-2,3-di(propan-2-yl)pyrrole has a molecular weight of 163.26 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidene-2,3-di(propan-2-yl)pyrrole is sourced from PubChem (CID 89449382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).