C8H15N3 — CID 89449600
N,1,3,4,5-pentamethylimidazol-2-imine (PubChem CID 89449600) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N,1,3,4,5-pentamethylimidazol-2-imine.
| Compound Name | N,1,3,4,5-pentamethylimidazol-2-imine |
|---|---|
| PubChem CID | 89449600 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N,1,3,4,5-pentamethylimidazol-2-imine |
| SMILES | CN=c1n(C)c(C)c(C)n1C |
| InChI | InChI=1S/C8H15N3/c1-6-7(2)11(5)8(9-3)10(6)4/h1-5H3 |
| InChIKey | YFZHUKXYNXDBFP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |