C30H36N4O6Si2 — CID 89449700
CID 89449700 (PubChem CID 89449700) has the molecular formula C30H36N4O6Si2 and a molecular weight of 604.81 g/mol.
| Compound Name | CID 89449700 |
|---|---|
| PubChem CID | 89449700 |
| Molecular Formula | C30H36N4O6Si2 |
| Molecular Weight | 604.81 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | — |
| SMILES | C[Si]COC(=O)Nc1cccc(Cc2cc(Cc3cccc(NC(=O)N(C)CCO)c3)cc(NC(=O)OC[Si]C)c2)c1 |
| InChI | InChI=1S/C30H36N4O6Si2/c1-34(10-11-35)28(36)31-25-8-4-6-21(15-25)12-23-14-24(18-27(17-23)33-30(38)40-20-42-3)13-22-7-5-9-26(16-22)32-29(37)39-19-41-2/h4-9,14-18,35H,10-13,19-20H2,1-3H3,(H,31,36)(H,32,37)(H,33,38) |
| InChIKey | VWARZAPZPNUBED-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|