About 2-fluoro-2H-furan-5-one
2-fluoro-2H-furan-5-one (PubChem CID 89449754) has the molecular formula C4H3FO2
and a molecular weight of 102.06 g/mol. Its IUPAC name is 2-fluoro-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-fluoro-2H-furan-5-one |
| PubChem CID | 89449754 |
| Molecular Formula | C4H3FO2 |
| Molecular Weight | 102.06 g/mol |
| Exact Mass | 102.01 |
| IUPAC Name | 2-fluoro-2H-furan-5-one |
| SMILES | O=C1C=CC(F)O1 |
| InChI | InChI=1S/C4H3FO2/c5-3-1-2-4(6)7-3/h1-3H |
| InChIKey | UDADLMARRHJKFD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.06 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2H-furan-5-one?
The IUPAC name of 2-fluoro-2H-furan-5-one (CID 89449754) is 2-fluoro-2H-furan-5-one.
What is the SMILES notation for 2-fluoro-2H-furan-5-one?
The canonical SMILES for 2-fluoro-2H-furan-5-one is O=C1C=CC(F)O1.
What is the InChIKey of 2-fluoro-2H-furan-5-one?
The InChIKey is UDADLMARRHJKFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FO2/c5-3-1-2-4(6)7-3/h1-3H.
What are the key properties of 2-fluoro-2H-furan-5-one?
2-fluoro-2H-furan-5-one has a molecular weight of 102.06 g/mol, XLogP of 0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2H-furan-5-one is sourced from PubChem (CID 89449754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).