About 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole
5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole (PubChem CID 89449955) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole.
Molecular Properties
| Compound Name | 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole |
| PubChem CID | 89449955 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole |
| SMILES | Cc1cnc2oc(C(C)C)cn12 |
| InChI | InChI=1S/C9H12N2O/c1-6(2)8-5-11-7(3)4-10-9(11)12-8/h4-6H,1-3H3 |
| InChIKey | GCZIEONLMMQRLI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole?
The IUPAC name of 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole (CID 89449955) is 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole.
What is the SMILES notation for 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole?
The canonical SMILES for 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole is Cc1cnc2oc(C(C)C)cn12.
What is the InChIKey of 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole?
The InChIKey is GCZIEONLMMQRLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-6(2)8-5-11-7(3)4-10-9(11)12-8/h4-6H,1-3H3.
What are the key properties of 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole?
5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole has a molecular weight of 164.21 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-propan-2-ylimidazo[2,1-b][1,3]oxazole is sourced from PubChem (CID 89449955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).