C13H23NO — CID 89450246
1-(2,5,5-trimethylhex-2-en-3-yl)pyrrolidin-2-one (PubChem CID 89450246) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-(2,5,5-trimethylhex-2-en-3-yl)pyrrolidin-2-one.
| Compound Name | 1-(2,5,5-trimethylhex-2-en-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 89450246 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-(2,5,5-trimethylhex-2-en-3-yl)pyrrolidin-2-one |
| SMILES | CC(C)=C(CC(C)(C)C)N1CCCC1=O |
| InChI | InChI=1S/C13H23NO/c1-10(2)11(9-13(3,4)5)14-8-6-7-12(14)15/h6-9H2,1-5H3 |
| InChIKey | GTIYODNDDWZJTP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |