C23H22N6O2 — CID 89450891
N-(6-oxo-1H-pyridin-3-yl)-5-(5-piperidin-1-yl-3-pyridinyl)-1H-indazole-3-carboxamide (PubChem CID 89450891) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-(6-oxo-1H-pyridin-3-yl)-5-(5-piperidin-1-yl-3-pyridinyl)-1H-indazole-3-carboxamide.
| Compound Name | N-(6-oxo-1H-pyridin-3-yl)-5-(5-piperidin-1-yl-3-pyridinyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 89450891 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-(6-oxo-1H-pyridin-3-yl)-5-(5-piperidin-1-yl-3-pyridinyl)-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(=O)[nH]c1)c1n[nH]c2ccc(-c3cncc(N4CCCCC4)c3)cc12 |
| InChI | InChI=1S/C23H22N6O2/c30-21-7-5-17(13-25-21)26-23(31)22-19-11-15(4-6-20(19)27-28-22)16-10-18(14-24-12-16)29-8-2-1-3-9-29/h4-7,10-14H,1-3,8-9H2,(H,25,30)(H,26,31)(H,27,28) |
| InChIKey | OJXHTWQJAOMIRD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |