C9H14O6 — CID 89451377
(Z,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,4-dihydroxybut-2-enoic acid (PubChem CID 89451377) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is (Z,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,4-dihydroxybut-2-enoic acid.
| Compound Name | (Z,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,4-dihydroxybut-2-enoic acid |
|---|---|
| PubChem CID | 89451377 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (Z,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,4-dihydroxybut-2-enoic acid |
| SMILES | CC1(C)OCC([C@@H](O)/C(O)=C/C(=O)O)O1 |
| InChI | InChI=1S/C9H14O6/c1-9(2)14-4-6(15-9)8(13)5(10)3-7(11)12/h3,6,8,10,13H,4H2,1-2H3,(H,11,12)/b5-3-/t6?,8-/m0/s1 |
| InChIKey | IPUQJXTTYSBEGD-CXQHQWCVSA-N |
| XLogP | 0.03 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|