About (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol
(3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol (PubChem CID 89451383) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol.
Molecular Properties
| Compound Name | (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol |
| PubChem CID | 89451383 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol |
| SMILES | C=C(/C=C\C(=C/C)CCO)OC |
| InChI | InChI=1S/C10H16O2/c1-4-10(7-8-11)6-5-9(2)12-3/h4-6,11H,2,7-8H2,1,3H3/b6-5-,10-4+ |
| InChIKey | ODMJPVOZZSCPDR-QYONPMAVSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol?
The IUPAC name of (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol (CID 89451383) is (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol.
What is the SMILES notation for (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol?
The canonical SMILES for (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol is C=C(/C=C\C(=C/C)CCO)OC.
What is the InChIKey of (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol?
The InChIKey is ODMJPVOZZSCPDR-QYONPMAVSA-N. The full InChI is InChI=1S/C10H16O2/c1-4-10(7-8-11)6-5-9(2)12-3/h4-6,11H,2,7-8H2,1,3H3/b6-5-,10-4+.
What are the key properties of (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol?
(3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol has a molecular weight of 168.24 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,4Z)-3-ethylidene-6-methoxyhepta-4,6-dien-1-ol is sourced from PubChem (CID 89451383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).